ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-98-8 metil 3- (klorosülfonil) -4-fenil-5- (triflorometil) tiyofen-2-karboksilat |
|
Ürün Adı | metil 3- (klorosülfonil) -4-fenil-5- (triflorometil) tiyofen-2-karboksilat |
Eş anlamlı | 1-{2-[(2-kloro-6-florobenzil)sülfanil]etil}-2-metil-5-fenil-1H-pirol-3-karboksilik asit; |
ingilizce adı | methyl 3-(chlorosulfonyl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylate;1-{2-[(2-chloro-6-fluorobenzyl)sulfanyl]ethyl}-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
Moleküler Formülü | C21H19ClFNO2S |
Molekül Ağırlığı | 403.8975 |
InChI | InChI=1/C21H19ClFNO2S/c1-14-16(21(25)26)12-20(15-6-3-2-4-7-15)24(14)10-11-27-13-17-18(22)8-5-9-19(17)23/h2-9,12H,10-11,13H2,1H3,(H,25,26) |
CAS kayıt numarası | 306935-98-8 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.27g/cm3 |
Ergime noktası | 68℃ |
Kaynama noktası | 566.6°C at 760 mmHg |
Kırılma indisi | 1.608 |
Alevlenme noktası | 296.5°C |
Buhar basıncı | 1.13E-13mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |