ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-98-8 metyl 3-(klorsulfonyl)-4-fenyl-5-(trifluormetyl)tiofen-2-karboksylat |
|
produktnavn | metyl 3-(klorsulfonyl)-4-fenyl-5-(trifluormetyl)tiofen-2-karboksylat |
Synonymer | 1-{2-[(2-klor-6-fluorbenzyl)sulfanyl]etyl}-2-metyl-5-fenyl-1H-pyrrol-3-karboksylsyre; |
Engelsk navn | methyl 3-(chlorosulfonyl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylate;1-{2-[(2-chloro-6-fluorobenzyl)sulfanyl]ethyl}-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
Molekylær Formel | C21H19ClFNO2S |
Molekylvekt | 403.8975 |
InChI | InChI=1/C21H19ClFNO2S/c1-14-16(21(25)26)12-20(15-6-3-2-4-7-15)24(14)10-11-27-13-17-18(22)8-5-9-19(17)23/h2-9,12H,10-11,13H2,1H3,(H,25,26) |
CAS-nummer | 306935-98-8 |
Molecular Structure | ![]() |
Tetthet | 1.27g/cm3 |
Smeltepunkt | 68℃ |
Kokepunkt | 566.6°C at 760 mmHg |
Brytningsindeks | 1.608 |
Flammepunktet | 296.5°C |
Damptrykk | 1.13E-13mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |