ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-98-8 متیل 3- (chlorosulfonyl) -4-فنیل-5- (trifluoromethyl) تیوفن-2-کربوکسیلات؛ 1- {2- [(2-chloro-6-fluorobenzyl) sulfanyl] اتیل}-2-متیل-5-فنیل-1H-پیرول-3-کربوکسیلیک اسید؛ |
|
نام محصول | متیل 3- (chlorosulfonyl) -4-فنیل-5- (trifluoromethyl) تیوفن-2-کربوکسیلات؛ 1- {2- [(2-chloro-6-fluorobenzyl) sulfanyl] اتیل}-2-متیل-5-فنیل-1H-پیرول-3-کربوکسیلیک اسید؛ |
نام انگلیسی | methyl 3-(chlorosulfonyl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylate;1-{2-[(2-chloro-6-fluorobenzyl)sulfanyl]ethyl}-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
میدان مغناطیسی | C21H19ClFNO2S |
وزن مولکولی | 403.8975 |
InChI | InChI=1/C21H19ClFNO2S/c1-14-16(21(25)26)12-20(15-6-3-2-4-7-15)24(14)10-11-27-13-17-18(22)8-5-9-19(17)23/h2-9,12H,10-11,13H2,1H3,(H,25,26) |
شماره سیایاس | 306935-98-8 |
ساختار مولکولی | ![]() |
تراکم | 1.27g/cm3 |
نقطه ذوب | 68℃ |
نقطه غلیان | 566.6°C at 760 mmHg |
ضریب شکست | 1.608 |
نقطه اشتعال | 296.5°C |
فشار بخار | 1.13E-13mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |