ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
453-11-2 1-Chloro-3-fluoro-2-propanol |
|
| 상품명칭 | 1-Chloro-3-fluoro-2-propanol |
| 영문 이름 | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
| 분자식 | C3H6ClFO |
| 분자량 | 112.5305 |
| InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| cas번호 | 453-11-2 |
| 분자 구조 | ![]() |
| 밀도 | 1.212g/cm3 |
| 비등점 | 158.1°C at 760 mmHg |
| 굴절 지수 | 1.399 |
| 인화점 | 49.4°C |
| 증기압 | 0.951mmHg at 25°C |
| 리스크 규칙 | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |