ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25584-83-2 hydroxypropyl acrylate, mixture of isomers |
|
| produktnavn | hydroxypropyl acrylate, mixture of isomers |
| Engelsk navn | hydroxypropyl acrylate, mixture of isomers;Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate |
| Molekylær Formel | C6H10O3 |
| Molekylvekt | 130.1418 |
| InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
| CAS-nummer | 25584-83-2 |
| EINECS | 247-118-0 |
| Molecular Structure | ![]() |
| Tetthet | 1.049g/cm3 |
| Kokepunkt | 175.4°C at 760 mmHg |
| Brytningsindeks | 1.442 |
| Flammepunktet | 64.3°C |
| Damptrykk | 0.355mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R23/24/25||R34||R43:; |
| Sikkerhet Beskrivelse | S26||S36/37/39||S45:; |
| MSDS | |