ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25584-83-2 hydroxypropyl acrylate, mixture of isomers |
|
| Nome do produto | hydroxypropyl acrylate, mixture of isomers |
| Nome em inglês | hydroxypropyl acrylate, mixture of isomers;Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate |
| Fórmula molecular | C6H10O3 |
| Peso Molecular | 130.1418 |
| InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
| CAS Registry Number | 25584-83-2 |
| EINECS | 247-118-0 |
| Estrutura Molecular | ![]() |
| Densidade | 1.049g/cm3 |
| Ponto de ebulição | 175.4°C at 760 mmHg |
| índice de refração | 1.442 |
| O ponto de inflamação | 64.3°C |
| Pressão de vapor | 0.355mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R23/24/25||R34||R43:; |
| Descrição da Segurança | S26||S36/37/39||S45:; |
| MSDS | |