ChemIndex - Бесплатная база данных CAS по химическим веществамToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25584-83-2 hydroxypropyl acrylate, mixture of isomers |
|
| Название продукта | hydroxypropyl acrylate, mixture of isomers |
| Английское название | hydroxypropyl acrylate, mixture of isomers;Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate |
| Молекулярная формула | C6H10O3 |
| Молекулярный вес | 130.1418 |
| InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
| Регистрационный номер CAS | 25584-83-2 |
| EINECS | 247-118-0 |
| Молекулярная структура | ![]() |
| Плотность | 1.049g/cm3 |
| Точка кипения | 175.4°C at 760 mmHg |
| Показатель преломления | 1.442 |
| Температура вспышки | 64.3°C |
| Давление пара | 0.355mmHg at 25°C |
| Символы опасности | |
| Риск коды | R23/24/25||R34||R43:; |
| Характеристики безопасности | S26||S36/37/39||S45:; |
| MSDS | |