ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25584-83-2 hydroxypropyl acrylate, mixture of isomers |
|
| اسم المنتج | hydroxypropyl acrylate, mixture of isomers |
| الاسم بالانجليزية | hydroxypropyl acrylate, mixture of isomers;Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate |
| الصيغة الجزيئية | C6H10O3 |
| الوزن الجزيئي الغرامي | 130.1418 |
| InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
| إستراتيجية المساعدة القطرية | 25584-83-2 |
| المفوضية الأوروبية رقم | 247-118-0 |
| بنية جزيئية | ![]() |
| كثافة | 1.049g/cm3 |
| نقطة الغليان | 175.4°C at 760 mmHg |
| معامل الإنكسار | 1.442 |
| نقطة الوميض | 64.3°C |
| ضغط البخار | 0.355mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R23/24/25||R34||R43:; |
| شروط الأمن | S26||S36/37/39||S45:; |
| MSDS | |