ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25584-83-2 hydroxypropyl acrylate, mixture of isomers |
|
| Ürün Adı | hydroxypropyl acrylate, mixture of isomers |
| ingilizce adı | hydroxypropyl acrylate, mixture of isomers;Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate |
| Moleküler Formülü | C6H10O3 |
| Molekül Ağırlığı | 130.1418 |
| InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
| CAS kayıt numarası | 25584-83-2 |
| EINECS | 247-118-0 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.049g/cm3 |
| Kaynama noktası | 175.4°C at 760 mmHg |
| Kırılma indisi | 1.442 |
| Alevlenme noktası | 64.3°C |
| Buhar basıncı | 0.355mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R23/24/25||R34||R43:; |
| Güvenlik Açıklaması | S26||S36/37/39||S45:; |
| MSDS | |