ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-17-2 Triphenylcarbenium hexafluorophosphate | 
			    |
| Chemical Name | Triphenylcarbenium hexafluorophosphate | 
| Synonyms | Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate | 
| Molecular Weight | 243.3219 | 
| InChl | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 | 
| CAS Registry Number | 437-17-2 | 
| EINECS | 207-112-0 | 
| Molecular Structure | ![]()  | 
			    
| Melting Point | 150℃ | 
| Hazard Symbols | |
| Risk Codes | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; | 
			    
| Safety Description | S28##After contact with skin, wash immediately with plenty of ...:; | 
			    
| MSDS | |