Chemindex > 437-17-2
IN ▼
437-17-2 Triphenylcarbenium hexafluorophosphate |
|
| उत्पाद का नाम | Triphenylcarbenium hexafluorophosphate |
| अंग्रेज | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate |
| आण्विक वजन | 243.3219 |
| InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
| कैस रजिस्टी संख्या | 437-17-2 |
| EINECS | 207-112-0 |
| आणविक संरचना |  |
| गलनांक | 150℃ |
| खतरा प्रतीक |  C##Corrosive:; |
| खतरे के कोड | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; |
| सुरक्षा विवरण | S28##After contact with skin, wash immediately with plenty of ...:; |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
437-17-2 (0) के लिए आपूर्तिकर्ता:
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 