ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-17-2 Triphenylcarbenium hexafluorophosphate | 
    |
| نام محصول | Triphenylcarbenium hexafluorophosphate | 
| نام انگلیسی | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate | 
| وزن مولکولی | 243.3219 | 
| InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 | 
| شماره سیایاس | 437-17-2 | 
| تعداد کمیسیون اروپایی | 207-112-0 | 
| ساختار مولکولی | ![]()  | 
    
| نقطه ذوب | 150℃ | 
| خطر نمادها | |
| کدهای خطر | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; | 
    
| توضیحات ایمنی | S28##After contact with skin, wash immediately with plenty of ...:; | 
    
| MSDS | |