Chemindex > 437-17-2
NO ▼
437-17-2 Triphenylcarbenium hexafluorophosphate |
|
| produktnavn | Triphenylcarbenium hexafluorophosphate |
| Engelsk navn | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate |
| Molekylvekt | 243.3219 |
| InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
| CAS-nummer | 437-17-2 |
| EINECS | 207-112-0 |
| Molecular Structure |  |
| Smeltepunkt | 150℃ |
| Hazard symboler |  C##Corrosive:; |
| Risiko Koder | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S28##After contact with skin, wash immediately with plenty of ...:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 437-17-2 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 