ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-17-2 Triphenylcarbenium hexafluorophosphate |
|
| 상품명칭 | Triphenylcarbenium hexafluorophosphate |
| 영문 이름 | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate |
| 분자량 | 243.3219 |
| InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
| cas번호 | 437-17-2 |
| EC번호 | 207-112-0 |
| 분자 구조 | ![]() |
| 녹는 점 | 150℃ |
| 위험성 표시 | |
| 리스크 규칙 | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; |
| 보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...:; |
| MSDS | |