ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-17-2 Triphenylcarbenium hexafluorophosphate | 
    |
| název výrobku | Triphenylcarbenium hexafluorophosphate | 
| Anglický název | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate | 
| Molekulová hmotnost | 243.3219 | 
| InChl | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 | 
| Registrační číslo CAS | 437-17-2 | 
| EINECS | 207-112-0 | 
| Molekulární struktura | ![]()  | 
    
| Bod tání | 150℃ | 
| Symbolů nebezpečnosti | |
| Riziko Codes | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; | 
    
| Bezpečnostní Popis | S28##After contact with skin, wash immediately with plenty of ...:; | 
    
| MSDS | |