ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate |
|
název výrobku | 2,1,3-benzothiadiazol-5-yl isothiocyanate |
Anglický název | 2,1,3-benzothiadiazol-5-yl isothiocyanate;5-isothiocyanato-2,1,3-benzothiadiazole |
Molekulární vzorec | C7H3N3S2 |
Molekulová hmotnost | 193.2488 |
InChl | InChI=1/C7H3N3S2/c11-4-8-5-1-2-6-7(3-5)10-12-9-6/h1-3H |
Registrační číslo CAS | 337508-62-0 |
Molekulární struktura | ![]() |
Hustota | 1.54g/cm3 |
Bod tání | 93℃ |
Bod varu | 332.6°C at 760 mmHg |
Index lomu | 1.807 |
Bod vzplanutí | 155°C |
Tlak par | 0.000278mmHg at 25°C |
Symbolů nebezpečnosti | |
Riziko Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |