ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate |
|
상품명칭 | 2,1,3-benzothiadiazol-5-yl isothiocyanate |
영문 이름 | 2,1,3-benzothiadiazol-5-yl isothiocyanate;5-isothiocyanato-2,1,3-benzothiadiazole |
분자식 | C7H3N3S2 |
분자량 | 193.2488 |
InChI | InChI=1/C7H3N3S2/c11-4-8-5-1-2-6-7(3-5)10-12-9-6/h1-3H |
cas번호 | 337508-62-0 |
분자 구조 | ![]() |
밀도 | 1.54g/cm3 |
녹는 점 | 93℃ |
비등점 | 332.6°C at 760 mmHg |
굴절 지수 | 1.807 |
인화점 | 155°C |
증기압 | 0.000278mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |