Chemindex > 337508-62-0
NO ▼
337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate |
|
| produktnavn | 2,1,3-benzothiadiazol-5-yl isothiocyanate |
| Engelsk navn | 2,1,3-benzothiadiazol-5-yl isothiocyanate;5-isothiocyanato-2,1,3-benzothiadiazole |
| Molekylær Formel | C7H3N3S2 |
| Molekylvekt | 193.2488 |
| InChI | InChI=1/C7H3N3S2/c11-4-8-5-1-2-6-7(3-5)10-12-9-6/h1-3H |
| CAS-nummer | 337508-62-0 |
| Molecular Structure |  |
| Tetthet | 1.54g/cm3 |
| Smeltepunkt | 93℃ |
| Kokepunkt | 332.6°C at 760 mmHg |
| Brytningsindeks | 1.807 |
| Flammepunktet | 155°C |
| Damptrykk | 0.000278mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 337508-62-0 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 