ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate |
|
Nazwa produktu: | 2,1,3-benzothiadiazol-5-yl isothiocyanate |
Angielska nazwa | 2,1,3-benzothiadiazol-5-yl isothiocyanate;5-isothiocyanato-2,1,3-benzothiadiazole |
MF | C7H3N3S2 |
Masie cząsteczkowej | 193.2488 |
InChI | InChI=1/C7H3N3S2/c11-4-8-5-1-2-6-7(3-5)10-12-9-6/h1-3H |
Nr CAS | 337508-62-0 |
Struktury molekularnej | ![]() |
Gęstość | 1.54g/cm3 |
Temperatura topnienia | 93℃ |
Temperatura wrzenia | 332.6°C at 760 mmHg |
Współczynnik załamania | 1.807 |
Temperatura zapłonu | 155°C |
Ciśnienie pary | 0.000278mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |