ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate |
|
اسم المنتج | 2,1,3-benzothiadiazol-5-yl isothiocyanate |
الاسم بالانجليزية | 2,1,3-benzothiadiazol-5-yl isothiocyanate;5-isothiocyanato-2,1,3-benzothiadiazole |
الصيغة الجزيئية | C7H3N3S2 |
الوزن الجزيئي الغرامي | 193.2488 |
InChI | InChI=1/C7H3N3S2/c11-4-8-5-1-2-6-7(3-5)10-12-9-6/h1-3H |
إستراتيجية المساعدة القطرية | 337508-62-0 |
بنية جزيئية | ![]() |
كثافة | 1.54g/cm3 |
درجة الإنصهار | 93℃ |
نقطة الغليان | 332.6°C at 760 mmHg |
معامل الإنكسار | 1.807 |
نقطة الوميض | 155°C |
ضغط البخار | 0.000278mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |