ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate |
|
उत्पाद का नाम | 2,1,3-benzothiadiazol-5-yl isothiocyanate |
अंग्रेज | 2,1,3-benzothiadiazol-5-yl isothiocyanate;5-isothiocyanato-2,1,3-benzothiadiazole |
आणविक फार्मूला | C7H3N3S2 |
आण्विक वजन | 193.2488 |
InChI | InChI=1/C7H3N3S2/c11-4-8-5-1-2-6-7(3-5)10-12-9-6/h1-3H |
कैस रजिस्टी संख्या | 337508-62-0 |
आणविक संरचना | ![]() |
घनत्व | 1.54g/cm3 |
गलनांक | 93℃ |
उबलने का समय | 332.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.807 |
फ्लैश प्वाइंट | 155°C |
वाष्प का दबाव | 0.000278mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |