ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
130560-97-3 3-chloro-4-fluorothiobenzamide |
|
Produkt-Name | 3-chloro-4-fluorothiobenzamide |
Englischer Name | 3-chloro-4-fluorothiobenzamide;3-Chloro-4-fluorobenzene-1-carbothioamide;3-chloro-4-fluorobenzenecarbothioamide |
Molekulare Formel | C7H5ClFNS |
Molecular Weight | 189.6377 |
InChl | InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
CAS Registry Number | 130560-97-3 |
Molecular Structure | ![]() |
Dichte | 1.434g/cm3 |
Schmelzpunkt | 129-130℃ |
Siedepunkt | 285.5°C at 760 mmHg |
Brechungsindex | 1.635 |
Flammpunkt | 126.5°C |
Dampfdruck | 0.00279mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R20/22##Harmful by inhalation and if swallowed.:; |
Safety Beschreibung | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |