ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
130560-97-3 3-chloro-4-fluorothiobenzamide |
|
Naam product | 3-chloro-4-fluorothiobenzamide |
Engelse naam | 3-chloro-4-fluorothiobenzamide;3-Chloro-4-fluorobenzene-1-carbothioamide;3-chloro-4-fluorobenzenecarbothioamide |
MF | C7H5ClFNS |
Molecuulgewicht | 189.6377 |
InChI | InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
CAS-nummer | 130560-97-3 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.434g/cm3 |
Smeltpunt | 129-130℃ |
Kookpunt | 285.5°C at 760 mmHg |
Brekingsindex | 1.635 |
Vlampunt | 126.5°C |
Dampdruk | 0.00279mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R20/22##Harmful by inhalation and if swallowed.:; |
Veiligheid Omschrijving | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |