ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
130560-97-3 3-chloro-4-fluorothiobenzamide |
|
Ürün Adı | 3-chloro-4-fluorothiobenzamide |
ingilizce adı | 3-chloro-4-fluorothiobenzamide;3-Chloro-4-fluorobenzene-1-carbothioamide;3-chloro-4-fluorobenzenecarbothioamide |
Moleküler Formülü | C7H5ClFNS |
Molekül Ağırlığı | 189.6377 |
InChI | InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
CAS kayıt numarası | 130560-97-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.434g/cm3 |
Ergime noktası | 129-130℃ |
Kaynama noktası | 285.5°C at 760 mmHg |
Kırılma indisi | 1.635 |
Alevlenme noktası | 126.5°C |
Buhar basıncı | 0.00279mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R20/22##Harmful by inhalation and if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |