ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
130560-97-3 3-chloro-4-fluorothiobenzamide |
|
שם המוצר | 3-chloro-4-fluorothiobenzamide |
שם אנגלי | 3-chloro-4-fluorothiobenzamide;3-Chloro-4-fluorobenzene-1-carbothioamide;3-chloro-4-fluorobenzenecarbothioamide |
מולקולרית פורמולה | C7H5ClFNS |
משקל מולקולרי | 189.6377 |
InChl | InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
מספר CAS | 130560-97-3 |
מבנה מולקולרי | ![]() |
צפיפות | 1.434g/cm3 |
נקודת ההתוך | 129-130℃ |
נקודת רתיחה | 285.5°C at 760 mmHg |
משקל סגולי | 1.635 |
נקודת הבזק | 126.5°C |
לחץ אדים | 0.00279mmHg at 25°C |
Hazard סימנים | |
סיכונים קודי | R20/22##Harmful by inhalation and if swallowed.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |