ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
130560-97-3 3-chloro-4-fluorothiobenzamide |
|
상품명칭 | 3-chloro-4-fluorothiobenzamide |
영문 이름 | 3-chloro-4-fluorothiobenzamide;3-Chloro-4-fluorobenzene-1-carbothioamide;3-chloro-4-fluorobenzenecarbothioamide |
분자식 | C7H5ClFNS |
분자량 | 189.6377 |
InChI | InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
cas번호 | 130560-97-3 |
분자 구조 | ![]() |
밀도 | 1.434g/cm3 |
녹는 점 | 129-130℃ |
비등점 | 285.5°C at 760 mmHg |
굴절 지수 | 1.635 |
인화점 | 126.5°C |
증기압 | 0.00279mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R20/22##Harmful by inhalation and if swallowed.:; |
보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |