ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
130560-97-3 3-chloro-4-fluorothiobenzamide |
|
produktnavn | 3-chloro-4-fluorothiobenzamide |
Engelsk navn | 3-chloro-4-fluorothiobenzamide;3-Chloro-4-fluorobenzene-1-carbothioamide;3-chloro-4-fluorobenzenecarbothioamide |
Molekylær Formel | C7H5ClFNS |
Molekylvekt | 189.6377 |
InChI | InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
CAS-nummer | 130560-97-3 |
Molecular Structure | ![]() |
Tetthet | 1.434g/cm3 |
Smeltepunkt | 129-130℃ |
Kokepunkt | 285.5°C at 760 mmHg |
Brytningsindeks | 1.635 |
Flammepunktet | 126.5°C |
Damptrykk | 0.00279mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R20/22##Harmful by inhalation and if swallowed.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |