ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
170572-49-3 3-Fluoro-4-methylbenzonitrile |
|
Produkt-Name | 3-Fluoro-4-methylbenzonitrile |
Englischer Name | 3-Fluoro-4-methylbenzonitrile;4-Cyano-2-fluorotoluene;3-Fluoro-p-tolunitrile |
Molekulare Formel | C8H6FN |
Molecular Weight | 135.1383 |
InChl | InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS Registry Number | 170572-49-3 |
Molecular Structure | ![]() |
Dichte | 1.117g/cm3 |
Schmelzpunkt | 48-50℃ |
Siedepunkt | 215.069°C at 760 mmHg |
Brechungsindex | 1.508 |
Flammpunkt | 90.3°C |
Dampfdruck | 0.151mmHg at 25°C |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |