ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
170572-49-3 3-Fluoro-4-methylbenzonitrile |
|
Nama produk | 3-Fluoro-4-methylbenzonitrile |
Nama bahasa Inggris | 3-Fluoro-4-methylbenzonitrile;4-Cyano-2-fluorotoluene;3-Fluoro-p-tolunitrile |
MF | C8H6FN |
Berat Molekul | 135.1383 |
InChI | InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS NO | 170572-49-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.117g/cm3 |
Titik lebur | 48-50℃ |
Titik didih | 215.069°C at 760 mmHg |
Indeks bias | 1.508 |
Titik nyala | 90.3°C |
Tekanan uap | 0.151mmHg at 25°C |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Deskripsi | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |