ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
170572-49-3 3-Fluoro-4-methylbenzonitrile |
|
produktnavn | 3-Fluoro-4-methylbenzonitrile |
Engelsk navn | 3-Fluoro-4-methylbenzonitrile;4-Cyano-2-fluorotoluene;3-Fluoro-p-tolunitrile |
Molekylær Formel | C8H6FN |
Molekylvekt | 135.1383 |
InChI | InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS-nummer | 170572-49-3 |
Molecular Structure | ![]() |
Tetthet | 1.117g/cm3 |
Smeltepunkt | 48-50℃ |
Kokepunkt | 215.069°C at 760 mmHg |
Brytningsindeks | 1.508 |
Flammepunktet | 90.3°C |
Damptrykk | 0.151mmHg at 25°C |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |