ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
170572-49-3 3-Fluoro-4-methylbenzonitrile |
|
Ονομασία του προϊόντος | 3-Fluoro-4-methylbenzonitrile |
Αγγλικό όνομα | 3-Fluoro-4-methylbenzonitrile;4-Cyano-2-fluorotoluene;3-Fluoro-p-tolunitrile |
MF | C8H6FN |
Μοριακό βάρος | 135.1383 |
InChI | InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS ΟΧΙ | 170572-49-3 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.117g/cm3 |
Σημείο τήξης | 48-50℃ |
Σημείο βρασμού | 215.069°C at 760 mmHg |
Δείκτης διάθλασης | 1.508 |
Σημείο ανάφλεξης | 90.3°C |
Πίεση ατμών | 0.151mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |