ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
170572-49-3 3-Fluoro-4-methylbenzonitrile |
|
Ürün Adı | 3-Fluoro-4-methylbenzonitrile |
ingilizce adı | 3-Fluoro-4-methylbenzonitrile;4-Cyano-2-fluorotoluene;3-Fluoro-p-tolunitrile |
Moleküler Formülü | C8H6FN |
Molekül Ağırlığı | 135.1383 |
InChI | InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS kayıt numarası | 170572-49-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.117g/cm3 |
Ergime noktası | 48-50℃ |
Kaynama noktası | 215.069°C at 760 mmHg |
Kırılma indisi | 1.508 |
Alevlenme noktası | 90.3°C |
Buhar basıncı | 0.151mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |