ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
170572-49-3 3-Fluoro-4-methylbenzonitrile |
|
Naam product | 3-Fluoro-4-methylbenzonitrile |
Engelse naam | 3-Fluoro-4-methylbenzonitrile;4-Cyano-2-fluorotoluene;3-Fluoro-p-tolunitrile |
MF | C8H6FN |
Molecuulgewicht | 135.1383 |
InChI | InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS-nummer | 170572-49-3 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.117g/cm3 |
Smeltpunt | 48-50℃ |
Kookpunt | 215.069°C at 760 mmHg |
Brekingsindex | 1.508 |
Vlampunt | 90.3°C |
Dampdruk | 0.151mmHg at 25°C |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Veiligheid Omschrijving | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |