ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2426-07-5 1,2,7,8-Diepoxyoctane |
|
| Produkt-Name | 1,2,7,8-Diepoxyoctane |
| Englischer Name | 1,2,7,8-Diepoxyoctane;Octadienediepoxide;1,7-Octadiene diepoxide;1,2,7,8-Dipoxyoctane, >97%;2,2'-butane-1,4-diyldioxirane;(2R,2'S)-2,2'-butane-1,4-diyldioxirane;(2S,2'S)-2,2'-butane-1,4-diyldioxirane |
| Molekulare Formel | C8H14O2 |
| Molecular Weight | 142.1956 |
| InChl | InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
| CAS Registry Number | 2426-07-5 |
| EINECS | 219-375-9 |
| Molecular Structure | ![]() |
| Dichte | 1.051g/cm3 |
| Siedepunkt | 240°C at 760 mmHg |
| Brechungsindex | 1.477 |
| Flammpunkt | 97.8°C |
| Dampfdruck | 0.0602mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R22##Harmful if swallowed.||R24##Toxic in contact with skin.||R40##Possible risks of irreversible effects.:; |
| Safety Beschreibung | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |