Chemindex > 2426-07-5
NL ▼
2426-07-5 1,2,7,8-Diepoxyoctane |
|
| Naam product | 1,2,7,8-Diepoxyoctane |
| Engelse naam | 1,2,7,8-Diepoxyoctane;Octadienediepoxide;1,7-Octadiene diepoxide;1,2,7,8-Dipoxyoctane, >97%;2,2'-butane-1,4-diyldioxirane;(2R,2'S)-2,2'-butane-1,4-diyldioxirane;(2S,2'S)-2,2'-butane-1,4-diyldioxirane |
| MF | C8H14O2 |
| Molecuulgewicht | 142.1956 |
| InChI | InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
| CAS-nummer | 2426-07-5 |
| EINECS | 219-375-9 |
| Moleculaire Structuur |  |
| Dichtheid | 1.051g/cm3 |
| Kookpunt | 240°C at 760 mmHg |
| Brekingsindex | 1.477 |
| Vlampunt | 97.8°C |
| Dampdruk | 0.0602mmHg at 25°C |
| Gevaarsymbolen |  T##Toxic:; |
| Risico-codes | R22##Harmful if swallowed.||R24##Toxic in contact with skin.||R40##Possible risks of irreversible effects.:; |
| Veiligheid Omschrijving | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 