ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2426-07-5 1,2,7,8-Diepoxyoctane |
|
Ονομασία του προϊόντος | 1,2,7,8-Diepoxyoctane |
Αγγλικό όνομα | 1,2,7,8-Diepoxyoctane;Octadienediepoxide;1,7-Octadiene diepoxide;1,2,7,8-Dipoxyoctane, >97%;2,2'-butane-1,4-diyldioxirane;(2R,2'S)-2,2'-butane-1,4-diyldioxirane;(2S,2'S)-2,2'-butane-1,4-diyldioxirane |
MF | C8H14O2 |
Μοριακό βάρος | 142.1956 |
InChI | InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
CAS ΟΧΙ | 2426-07-5 |
EINECS | 219-375-9 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.051g/cm3 |
Σημείο βρασμού | 240°C at 760 mmHg |
Δείκτης διάθλασης | 1.477 |
Σημείο ανάφλεξης | 97.8°C |
Πίεση ατμών | 0.0602mmHg at 25°C |
Σύμβολα επικινδυνότητας | |
Κινδύνου Κώδικες | R22##Harmful if swallowed.||R24##Toxic in contact with skin.||R40##Possible risks of irreversible effects.:; |
Περιγραφή της ασφάλειας | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |