ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2426-07-5 1,2,7,8-Diepoxyoctane |
|
| نام محصول | 1,2,7,8-Diepoxyoctane |
| نام انگلیسی | 1,2,7,8-Diepoxyoctane;Octadienediepoxide;1,7-Octadiene diepoxide;1,2,7,8-Dipoxyoctane, >97%;2,2'-butane-1,4-diyldioxirane;(2R,2'S)-2,2'-butane-1,4-diyldioxirane;(2S,2'S)-2,2'-butane-1,4-diyldioxirane |
| میدان مغناطیسی | C8H14O2 |
| وزن مولکولی | 142.1956 |
| InChI | InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
| شماره سیایاس | 2426-07-5 |
| تعداد کمیسیون اروپایی | 219-375-9 |
| ساختار مولکولی | ![]() |
| تراکم | 1.051g/cm3 |
| نقطه غلیان | 240°C at 760 mmHg |
| ضریب شکست | 1.477 |
| نقطه اشتعال | 97.8°C |
| فشار بخار | 0.0602mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R22##Harmful if swallowed.||R24##Toxic in contact with skin.||R40##Possible risks of irreversible effects.:; |
| توضیحات ایمنی | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |