ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2426-07-5 1,2,7,8-Diepoxyoctane |
|
상품명칭 | 1,2,7,8-Diepoxyoctane |
영문 이름 | 1,2,7,8-Diepoxyoctane;Octadienediepoxide;1,7-Octadiene diepoxide;1,2,7,8-Dipoxyoctane, >97%;2,2'-butane-1,4-diyldioxirane;(2R,2'S)-2,2'-butane-1,4-diyldioxirane;(2S,2'S)-2,2'-butane-1,4-diyldioxirane |
분자식 | C8H14O2 |
분자량 | 142.1956 |
InChI | InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
cas번호 | 2426-07-5 |
EC번호 | 219-375-9 |
분자 구조 | ![]() |
밀도 | 1.051g/cm3 |
비등점 | 240°C at 760 mmHg |
굴절 지수 | 1.477 |
인화점 | 97.8°C |
증기압 | 0.0602mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R22##Harmful if swallowed.||R24##Toxic in contact with skin.||R40##Possible risks of irreversible effects.:; |
보안 규칙 | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |