ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2426-07-5 1,2,7,8-Diepoxyoctane |
|
| اسم المنتج | 1,2,7,8-Diepoxyoctane |
| الاسم بالانجليزية | 1,2,7,8-Diepoxyoctane;Octadienediepoxide;1,7-Octadiene diepoxide;1,2,7,8-Dipoxyoctane, >97%;2,2'-butane-1,4-diyldioxirane;(2R,2'S)-2,2'-butane-1,4-diyldioxirane;(2S,2'S)-2,2'-butane-1,4-diyldioxirane |
| الصيغة الجزيئية | C8H14O2 |
| الوزن الجزيئي الغرامي | 142.1956 |
| InChI | InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
| إستراتيجية المساعدة القطرية | 2426-07-5 |
| المفوضية الأوروبية رقم | 219-375-9 |
| بنية جزيئية | ![]() |
| كثافة | 1.051g/cm3 |
| نقطة الغليان | 240°C at 760 mmHg |
| معامل الإنكسار | 1.477 |
| نقطة الوميض | 97.8°C |
| ضغط البخار | 0.0602mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R22##Harmful if swallowed.||R24##Toxic in contact with skin.||R40##Possible risks of irreversible effects.:; |
| شروط الأمن | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |