ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-95-8 3-(1H-pyrrol-1-yl)benzylamin |
|
Produkt-Name | 3-(1H-pyrrol-1-yl)benzylamin |
Synonyme | 1-[3-(1H-pyrrol-1-yl)phenyl]methanamin; |
Englischer Name | 3-(1H-pyrrol-1-yl)benzylamine;1-[3-(1H-pyrrol-1-yl)phenyl]methanamine |
Molekulare Formel | C11H12N2 |
Molecular Weight | 172.2264 |
InChl | InChI=1/C11H12N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9,12H2 |
CAS Registry Number | 368869-95-8 |
Molecular Structure | ![]() |
Dichte | 1.07g/cm3 |
Siedepunkt | 317.7°C at 760 mmHg |
Brechungsindex | 1.589 |
Flammpunkt | 145.9°C |
Dampfdruck | 0.000379mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |