ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-95-8 3-(1H-피롤-1-일)벤질아민 |
|
상품명칭 | 3-(1H-피롤-1-일)벤질아민 |
별명 | 1-[3-(1H-피롤-1-일)페닐]메타나민; |
영문 이름 | 3-(1H-pyrrol-1-yl)benzylamine;1-[3-(1H-pyrrol-1-yl)phenyl]methanamine |
분자식 | C11H12N2 |
분자량 | 172.2264 |
InChI | InChI=1/C11H12N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9,12H2 |
cas번호 | 368869-95-8 |
분자 구조 | ![]() |
밀도 | 1.07g/cm3 |
비등점 | 317.7°C at 760 mmHg |
굴절 지수 | 1.589 |
인화점 | 145.9°C |
증기압 | 0.000379mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |