ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-95-8 3-(1H-pyrrol-1-yl)benzylamin |
|
produktnavn | 3-(1H-pyrrol-1-yl)benzylamin |
Synonymer | 1-[3-(1H-pyrrol-1-yl)fenyl]metamin; |
Engelsk navn | 3-(1H-pyrrol-1-yl)benzylamine;1-[3-(1H-pyrrol-1-yl)phenyl]methanamine |
Molekylær Formel | C11H12N2 |
Molekylvekt | 172.2264 |
InChI | InChI=1/C11H12N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9,12H2 |
CAS-nummer | 368869-95-8 |
Molecular Structure | ![]() |
Tetthet | 1.07g/cm3 |
Kokepunkt | 317.7°C at 760 mmHg |
Brytningsindeks | 1.589 |
Flammepunktet | 145.9°C |
Damptrykk | 0.000379mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |