ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-95-8 3- (1H-pirol-1-il) benzilamin |
|
| Ürün Adı | 3- (1H-pirol-1-il) benzilamin |
| Eş anlamlı | 1- [3- (1H-pirol-1-il) fenil] metanamin; |
| ingilizce adı | 3-(1H-pyrrol-1-yl)benzylamine;1-[3-(1H-pyrrol-1-yl)phenyl]methanamine |
| Moleküler Formülü | C11H12N2 |
| Molekül Ağırlığı | 172.2264 |
| InChI | InChI=1/C11H12N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9,12H2 |
| CAS kayıt numarası | 368869-95-8 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.07g/cm3 |
| Kaynama noktası | 317.7°C at 760 mmHg |
| Kırılma indisi | 1.589 |
| Alevlenme noktası | 145.9°C |
| Buhar basıncı | 0.000379mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R34##Causes burns.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |