ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-95-8 3-(1H-pyrrol-1-yl)benzylamine |
|
Nama produk | 3-(1H-pyrrol-1-yl)benzylamine |
Sinonim | 1-[3-(1H-pyrrol-1-yl)phenyl]methanamine; |
Nama Inggeris | 3-(1H-pyrrol-1-yl)benzylamine;1-[3-(1H-pyrrol-1-yl)phenyl]methanamine |
MF | C11H12N2 |
Berat Molekul | 172.2264 |
InChI | InChI=1/C11H12N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9,12H2 |
CAS NO | 368869-95-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.07g/cm3 |
Titik didih | 317.7°C at 760 mmHg |
Indeks bias | 1.589 |
Titik nyala | 145.9°C |
Tekanan wap | 0.000379mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |