ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-95-8 3- (1H-pyrrol-1-yl) بنزیلامین؛ 1- [3- (1H-pyrrol-1-yl) فنیل] متانامین؛ |
|
نام محصول | 3- (1H-pyrrol-1-yl) بنزیلامین؛ 1- [3- (1H-pyrrol-1-yl) فنیل] متانامین؛ |
نام انگلیسی | 3-(1H-pyrrol-1-yl)benzylamine;1-[3-(1H-pyrrol-1-yl)phenyl]methanamine |
میدان مغناطیسی | C11H12N2 |
وزن مولکولی | 172.2264 |
InChI | InChI=1/C11H12N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9,12H2 |
شماره سیایاس | 368869-95-8 |
ساختار مولکولی | ![]() |
تراکم | 1.07g/cm3 |
نقطه غلیان | 317.7°C at 760 mmHg |
ضریب شکست | 1.589 |
نقطه اشتعال | 145.9°C |
فشار بخار | 0.000379mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |