ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4458-33-7 Di-n-butylethylamin |
|
Produkt-Name | Di-n-butylethylamin |
Synonyme | N-Ethyldibutylamin; N-Butyl-N-ethylbutan-1-amin; |
Englischer Name | Di-n-butylethylamine;N-Ethyldibutylamine;N-butyl-N-ethylbutan-1-amine |
Molekulare Formel | C10H23N |
Molecular Weight | 157.2963 |
InChl | InChI=1/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3 |
CAS Registry Number | 4458-33-7 |
EINECS | 224-711-2 |
Molecular Structure | ![]() |
Dichte | 0.783g/cm3 |
Siedepunkt | 182.8°C at 760 mmHg |
Brechungsindex | 1.432 |
Flammpunkt | 52.6°C |
Dampfdruck | 0.795mmHg at 25°C |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |