ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4458-33-7 دی-ان-بوتیلثیلامین؛ N-اتیلدی بوتیلامین؛ N-butyl-N-اتیل بوتان-1-امین؛ |
|
نام محصول | دی-ان-بوتیلثیلامین؛ N-اتیلدی بوتیلامین؛ N-butyl-N-اتیل بوتان-1-امین؛ |
نام انگلیسی | Di-n-butylethylamine;N-Ethyldibutylamine;N-butyl-N-ethylbutan-1-amine |
میدان مغناطیسی | C10H23N |
وزن مولکولی | 157.2963 |
InChI | InChI=1/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3 |
شماره سیایاس | 4458-33-7 |
تعداد کمیسیون اروپایی | 224-711-2 |
ساختار مولکولی | ![]() |
تراکم | 0.783g/cm3 |
نقطه غلیان | 182.8°C at 760 mmHg |
ضریب شکست | 1.432 |
نقطه اشتعال | 52.6°C |
فشار بخار | 0.795mmHg at 25°C |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |