ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4458-33-7 די-אן-בוטילאתילאמין |
|
שם המוצר | די-אן-בוטילאתילאמין |
נרדפות | N-Ethyldibutylamine; N-butyl-N-ethylbutan-1-אמין; |
שם אנגלי | Di-n-butylethylamine;N-Ethyldibutylamine;N-butyl-N-ethylbutan-1-amine |
מולקולרית פורמולה | C10H23N |
משקל מולקולרי | 157.2963 |
InChl | InChI=1/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3 |
מספר CAS | 4458-33-7 |
EINECS | 224-711-2 |
מבנה מולקולרי | ![]() |
צפיפות | 0.783g/cm3 |
נקודת רתיחה | 182.8°C at 760 mmHg |
משקל סגולי | 1.432 |
נקודת הבזק | 52.6°C |
לחץ אדים | 0.795mmHg at 25°C |
סיכונים קודי | R34##Causes burns.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |