ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4458-33-7 Di-n-butyletyloetyloamina |
|
Nazwa produktu: | Di-n-butyletyloetyloamina |
Synonimy | N-etylodibutyloamina; N-butylo-N-etylobutan-1-amina; |
Angielska nazwa | Di-n-butylethylamine;N-Ethyldibutylamine;N-butyl-N-ethylbutan-1-amine |
MF | C10H23N |
Masie cząsteczkowej | 157.2963 |
InChI | InChI=1/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3 |
Nr CAS | 4458-33-7 |
EINECS | 224-711-2 |
Struktury molekularnej | ![]() |
Gęstość | 0.783g/cm3 |
Temperatura wrzenia | 182.8°C at 760 mmHg |
Współczynnik załamania | 1.432 |
Temperatura zapłonu | 52.6°C |
Ciśnienie pary | 0.795mmHg at 25°C |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |