ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4458-33-7 Di-n-butyletylamin |
|
produktnavn | Di-n-butyletylamin |
Synonymer | N-etyldibutylamin; N-butyl-N-etylbutan-1-amin; |
Engelsk navn | Di-n-butylethylamine;N-Ethyldibutylamine;N-butyl-N-ethylbutan-1-amine |
Molekylær Formel | C10H23N |
Molekylvekt | 157.2963 |
InChI | InChI=1/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3 |
CAS-nummer | 4458-33-7 |
EINECS | 224-711-2 |
Molecular Structure | ![]() |
Tetthet | 0.783g/cm3 |
Kokepunkt | 182.8°C at 760 mmHg |
Brytningsindeks | 1.432 |
Flammepunktet | 52.6°C |
Damptrykk | 0.795mmHg at 25°C |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |